|
|
| Line 1: |
Line 1: |
| {{OSDDMalaria}}
| |
|
| |
|
| This series has the general structure:<br>
| |
|
| |
| [[Image:Arylpyrrole Generic.png|none|left|120px|GSK Tres Cantos Arylpyrrole Generic Structure]]<br>
| |
| <br>
| |
|
| |
| These compounds are currently under study by the Todd lab at the University of Sydney and the Medicines for Malaria Venture, Geneva. As an open source project, anyone may participate:<br>
| |
| Coordination/Discussion site:<br>
| |
| Electronic Lab Notebooks:<br>
| |
| Feeds:<br>
| |
|
| |
| Known series examples:<br>
| |
|
| |
| '''TCMDC 123812'''<br>
| |
|
| |
| [[Image:Arylpyrrole 1.png|none|left|260px|TCMDC123812]]<br>
| |
| <br>
| |
|
| |
| InChI=1/C15H15FN2O3/c1-9-7-13(15(20)21-8-14(17)19)10(2)18(9)12-5-3-11(16)4-6-12/h3-7H,8H2,1-2H3,(H2,17,19)<br>
| |
| SMILES: O=C(N)COC(=O)c2c(n(c1ccc(F)cc1)c(c2)C)C<br>
| |
| CAS Registry Number: 733026-12-5<br>
| |
| [http://www.chemspider.com/Chemical-Structure.1817204.html Chemspider page]<br>
| |
| [https://www.ebi.ac.uk/chembldb/index.php/compound/inspect/639434# ChEMBL Page]<br>
| |
| Resynthesis:<br>
| |
|
| |
| '''TCMDC 123794'''<br>
| |
|
| |
| [[Image:Arylpyrrole 2.png|none|left|260px|TCMDC123794]]<br>
| |
| <br>
| |
|
| |
| InChI=1/C26H25FN4O4/c1-16-14-22(17(2)30(16)20-12-10-19(27)11-13-20)26(34)35-15-23(32)28-24-18(3)29(4)31(25(24)33)21-8-6-5-7-9-21/h5-14H,15H2,1-4H3,(H,28,32)<br>
| |
| SMILES: Fc1ccc(cc1)n2c(cc(c2C)C(=O)OCC(=O)NC=4C(=O)N(c3ccccc3)N(C=4C)C)C<br>
| |
| [http://www.chemspider.com/Chemical-Structure.1769782.html Chemspider page]<br>
| |
| [https://www.ebi.ac.uk/chembldb/index.php/compound/inspect/632992 ChEMBL Page]<br>
| |
| Resynthesis:<br>
| |
|
| |
| Proposed Resynthesis Strategy:<br>
| |
| [[Image:arylpyrrolesynth.png|none|600px|left|Proposed Strategy]]<br>
| |
